C20H28N2O6S — CID 55968191
ethyl 1-[[2-[(4-acetylphenyl)sulfonyl-methylamino]acetyl]amino]cyclohexane-1-carboxylate (PubChem CID 55968191) has the molecular formula C20H28N2O6S and a molecular weight of 424.52 g/mol. Its IUPAC name is ethyl 1-[[2-[(4-acetylphenyl)sulfonyl-methylamino]acetyl]amino]cyclohexane-1-carboxylate.
| Compound Name | ethyl 1-[[2-[(4-acetylphenyl)sulfonyl-methylamino]acetyl]amino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 55968191 |
| Molecular Formula | C20H28N2O6S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | ethyl 1-[[2-[(4-acetylphenyl)sulfonyl-methylamino]acetyl]amino]cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1(NC(=O)CN(C)S(=O)(=O)c2ccc(C(C)=O)cc2)CCCCC1 |
| InChI | InChI=1S/C20H28N2O6S/c1-4-28-19(25)20(12-6-5-7-13-20)21-18(24)14-22(3)29(26,27)17-10-8-16(9-11-17)15(2)23/h8-11H,4-7,12-14H2,1-3H3,(H,21,24) |
| InChIKey | YFUPFAKTDOPHQH-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |