C19H19N3O5S — CID 7870968
(4-cyanophenyl)methyl 2-[(4-acetamidophenyl)sulfonyl-methylamino]acetate (PubChem CID 7870968) has the molecular formula C19H19N3O5S and a molecular weight of 401.44 g/mol. Its IUPAC name is (4-cyanophenyl)methyl 2-[(4-acetamidophenyl)sulfonyl-methylamino]acetate.
| Compound Name | (4-cyanophenyl)methyl 2-[(4-acetamidophenyl)sulfonyl-methylamino]acetate |
|---|---|
| PubChem CID | 7870968 |
| Molecular Formula | C19H19N3O5S |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | (4-cyanophenyl)methyl 2-[(4-acetamidophenyl)sulfonyl-methylamino]acetate |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N(C)CC(=O)OCc2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C19H19N3O5S/c1-14(23)21-17-7-9-18(10-8-17)28(25,26)22(2)12-19(24)27-13-16-5-3-15(11-20)4-6-16/h3-10H,12-13H2,1-2H3,(H,21,23) |
| InChIKey | NBVFAVGFMHHQAQ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 116.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |