C17H22N2O6S — CID 25163420
(2-oxocyclohexyl) 2-[(4-acetamidophenyl)sulfonyl-methylamino]acetate (PubChem CID 25163420) has the molecular formula C17H22N2O6S and a molecular weight of 382.44 g/mol. Its IUPAC name is (2-oxocyclohexyl) 2-[(4-acetamidophenyl)sulfonyl-methylamino]acetate.
| Compound Name | (2-oxocyclohexyl) 2-[(4-acetamidophenyl)sulfonyl-methylamino]acetate |
|---|---|
| PubChem CID | 25163420 |
| Molecular Formula | C17H22N2O6S |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | (2-oxocyclohexyl) 2-[(4-acetamidophenyl)sulfonyl-methylamino]acetate |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N(C)CC(=O)OC2CCCCC2=O)cc1 |
| InChI | InChI=1S/C17H22N2O6S/c1-12(20)18-13-7-9-14(10-8-13)26(23,24)19(2)11-17(22)25-16-6-4-3-5-15(16)21/h7-10,16H,3-6,11H2,1-2H3,(H,18,20) |
| InChIKey | TZWIDMGCFRFVAG-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |