C16H20N2O4S — CID 24662229
cyclohexyl 2-[(4-cyanophenyl)sulfonyl-methylamino]acetate (PubChem CID 24662229) has the molecular formula C16H20N2O4S and a molecular weight of 336.41 g/mol. Its IUPAC name is cyclohexyl 2-[(4-cyanophenyl)sulfonyl-methylamino]acetate.
| Compound Name | cyclohexyl 2-[(4-cyanophenyl)sulfonyl-methylamino]acetate |
|---|---|
| PubChem CID | 24662229 |
| Molecular Formula | C16H20N2O4S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | cyclohexyl 2-[(4-cyanophenyl)sulfonyl-methylamino]acetate |
| SMILES | CN(CC(=O)OC1CCCCC1)S(=O)(=O)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C16H20N2O4S/c1-18(12-16(19)22-14-5-3-2-4-6-14)23(20,21)15-9-7-13(11-17)8-10-15/h7-10,14H,2-6,12H2,1H3 |
| InChIKey | HKHLHNXRHWPPSC-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |