C16H12BrClN2O4S — CID 24663805
(2-bromo-4-chlorophenyl) 2-[(4-cyanophenyl)sulfonyl-methylamino]acetate (PubChem CID 24663805) has the molecular formula C16H12BrClN2O4S and a molecular weight of 443.71 g/mol. Its IUPAC name is (2-bromo-4-chlorophenyl) 2-[(4-cyanophenyl)sulfonyl-methylamino]acetate.
| Compound Name | (2-bromo-4-chlorophenyl) 2-[(4-cyanophenyl)sulfonyl-methylamino]acetate |
|---|---|
| PubChem CID | 24663805 |
| Molecular Formula | C16H12BrClN2O4S |
| Molecular Weight | 443.71 g/mol |
| Exact Mass | 441.94 |
| IUPAC Name | (2-bromo-4-chlorophenyl) 2-[(4-cyanophenyl)sulfonyl-methylamino]acetate |
| SMILES | CN(CC(=O)Oc1ccc(Cl)cc1Br)S(=O)(=O)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C16H12BrClN2O4S/c1-20(25(22,23)13-5-2-11(9-19)3-6-13)10-16(21)24-15-7-4-12(18)8-14(15)17/h2-8H,10H2,1H3 |
| InChIKey | NMDZSGSYOAGLSE-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.71 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|