C20H26N4O9PS2+ — CID 70371614
bis[[(4-acetamidophenyl)sulfonyl-methylamino]methoxy]-oxophosphanium (PubChem CID 70371614) has the molecular formula C20H26N4O9PS2+ and a molecular weight of 561.56 g/mol. Its IUPAC name is bis[[(4-acetamidophenyl)sulfonyl-methylamino]methoxy]-oxophosphanium.
| Compound Name | bis[[(4-acetamidophenyl)sulfonyl-methylamino]methoxy]-oxophosphanium |
|---|---|
| PubChem CID | 70371614 |
| Molecular Formula | C20H26N4O9PS2+ |
| Molecular Weight | 561.56 g/mol |
| Exact Mass | 561.09 |
| IUPAC Name | bis[[(4-acetamidophenyl)sulfonyl-methylamino]methoxy]-oxophosphanium |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N(C)CO[P+](=O)OCN(C)S(=O)(=O)c2ccc(NC(C)=O)cc2)cc1 |
| InChI | InChI=1S/C20H25N4O9PS2/c1-15(25)21-17-5-9-19(10-6-17)35(28,29)23(3)13-32-34(27)33-14-24(4)36(30,31)20-11-7-18(8-12-20)22-16(2)26/h5-12H,13-14H2,1-4H3,(H-,21,22,25,26)/p+1 |
| InChIKey | SGKSFZATPWOVCL-UHFFFAOYSA-O |
| XLogP | 2.15 |
| TPSA | 168.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.56 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|