C17H20N2O4S — CID 60554600
3-pyridin-4-ylpropyl 2-[benzenesulfonyl(methyl)amino]acetate (PubChem CID 60554600) has the molecular formula C17H20N2O4S and a molecular weight of 348.42 g/mol. Its IUPAC name is 3-pyridin-4-ylpropyl 2-[benzenesulfonyl(methyl)amino]acetate.
| Compound Name | 3-pyridin-4-ylpropyl 2-[benzenesulfonyl(methyl)amino]acetate |
|---|---|
| PubChem CID | 60554600 |
| Molecular Formula | C17H20N2O4S |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 3-pyridin-4-ylpropyl 2-[benzenesulfonyl(methyl)amino]acetate |
| SMILES | CN(CC(=O)OCCCc1ccncc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H20N2O4S/c1-19(24(21,22)16-7-3-2-4-8-16)14-17(20)23-13-5-6-15-9-11-18-12-10-15/h2-4,7-12H,5-6,13-14H2,1H3 |
| InChIKey | GGDOVXDUPJSBJM-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|