C15H17ClN2O4S2 — CID 78772421
3-pyridin-3-ylpropyl 2-[(5-chlorothiophen-2-yl)sulfonyl-methylamino]acetate (PubChem CID 78772421) has the molecular formula C15H17ClN2O4S2 and a molecular weight of 388.90 g/mol. Its IUPAC name is 3-pyridin-3-ylpropyl 2-[(5-chlorothiophen-2-yl)sulfonyl-methylamino]acetate.
| Compound Name | 3-pyridin-3-ylpropyl 2-[(5-chlorothiophen-2-yl)sulfonyl-methylamino]acetate |
|---|---|
| PubChem CID | 78772421 |
| Molecular Formula | C15H17ClN2O4S2 |
| Molecular Weight | 388.90 g/mol |
| Exact Mass | 388.03 |
| IUPAC Name | 3-pyridin-3-ylpropyl 2-[(5-chlorothiophen-2-yl)sulfonyl-methylamino]acetate |
| SMILES | CN(CC(=O)OCCCc1cccnc1)S(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C15H17ClN2O4S2/c1-18(24(20,21)15-7-6-13(16)23-15)11-14(19)22-9-3-5-12-4-2-8-17-10-12/h2,4,6-8,10H,3,5,9,11H2,1H3 |
| InChIKey | BTMPQYIVEVJEDZ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.90 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|