C16H17BrN2O3S — CID 55884310
3-pyridin-3-ylpropyl 2-[(5-bromothiophene-2-carbonyl)-methylamino]acetate (PubChem CID 55884310) has the molecular formula C16H17BrN2O3S and a molecular weight of 397.29 g/mol. Its IUPAC name is 3-pyridin-3-ylpropyl 2-[(5-bromothiophene-2-carbonyl)-methylamino]acetate.
| Compound Name | 3-pyridin-3-ylpropyl 2-[(5-bromothiophene-2-carbonyl)-methylamino]acetate |
|---|---|
| PubChem CID | 55884310 |
| Molecular Formula | C16H17BrN2O3S |
| Molecular Weight | 397.29 g/mol |
| Exact Mass | 396.01 |
| IUPAC Name | 3-pyridin-3-ylpropyl 2-[(5-bromothiophene-2-carbonyl)-methylamino]acetate |
| SMILES | CN(CC(=O)OCCCc1cccnc1)C(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C16H17BrN2O3S/c1-19(16(21)13-6-7-14(17)23-13)11-15(20)22-9-3-5-12-4-2-8-18-10-12/h2,4,6-8,10H,3,5,9,11H2,1H3 |
| InChIKey | BUMYEFKXBGLOKW-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.29 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|