C15H15ClFNO5S2 — CID 7804721
2-(4-fluorophenoxy)ethyl 2-[(5-chlorothiophen-2-yl)sulfonyl-methylamino]acetate (PubChem CID 7804721) has the molecular formula C15H15ClFNO5S2 and a molecular weight of 407.87 g/mol. Its IUPAC name is 2-(4-fluorophenoxy)ethyl 2-[(5-chlorothiophen-2-yl)sulfonyl-methylamino]acetate.
| Compound Name | 2-(4-fluorophenoxy)ethyl 2-[(5-chlorothiophen-2-yl)sulfonyl-methylamino]acetate |
|---|---|
| PubChem CID | 7804721 |
| Molecular Formula | C15H15ClFNO5S2 |
| Molecular Weight | 407.87 g/mol |
| Exact Mass | 407.01 |
| IUPAC Name | 2-(4-fluorophenoxy)ethyl 2-[(5-chlorothiophen-2-yl)sulfonyl-methylamino]acetate |
| SMILES | CN(CC(=O)OCCOc1ccc(F)cc1)S(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C15H15ClFNO5S2/c1-18(25(20,21)15-7-6-13(16)24-15)10-14(19)23-9-8-22-12-4-2-11(17)3-5-12/h2-7H,8-10H2,1H3 |
| InChIKey | KYZTVRJZVHUBNW-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.87 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|