C13H10Cl3NO4S2 — CID 18287790
(2,4-dichlorophenyl) 2-[(5-chlorothiophen-2-yl)sulfonyl-methylamino]acetate (PubChem CID 18287790) has the molecular formula C13H10Cl3NO4S2 and a molecular weight of 414.72 g/mol. Its IUPAC name is (2,4-dichlorophenyl) 2-[(5-chlorothiophen-2-yl)sulfonyl-methylamino]acetate.
| Compound Name | (2,4-dichlorophenyl) 2-[(5-chlorothiophen-2-yl)sulfonyl-methylamino]acetate |
|---|---|
| PubChem CID | 18287790 |
| Molecular Formula | C13H10Cl3NO4S2 |
| Molecular Weight | 414.72 g/mol |
| Exact Mass | 412.91 |
| IUPAC Name | (2,4-dichlorophenyl) 2-[(5-chlorothiophen-2-yl)sulfonyl-methylamino]acetate |
| SMILES | CN(CC(=O)Oc1ccc(Cl)cc1Cl)S(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C13H10Cl3NO4S2/c1-17(23(19,20)13-5-4-11(16)22-13)7-12(18)21-10-3-2-8(14)6-9(10)15/h2-6H,7H2,1H3 |
| InChIKey | WLENCESDSHCWTG-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.72 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|