C13H11Cl2NO4S2 — CID 16560681
(2,4-dichlorophenyl) 2-[methyl(thiophen-2-ylsulfonyl)amino]acetate (PubChem CID 16560681) has the molecular formula C13H11Cl2NO4S2 and a molecular weight of 380.27 g/mol. Its IUPAC name is (2,4-dichlorophenyl) 2-[methyl(thiophen-2-ylsulfonyl)amino]acetate.
| Compound Name | (2,4-dichlorophenyl) 2-[methyl(thiophen-2-ylsulfonyl)amino]acetate |
|---|---|
| PubChem CID | 16560681 |
| Molecular Formula | C13H11Cl2NO4S2 |
| Molecular Weight | 380.27 g/mol |
| Exact Mass | 378.95 |
| IUPAC Name | (2,4-dichlorophenyl) 2-[methyl(thiophen-2-ylsulfonyl)amino]acetate |
| SMILES | CN(CC(=O)Oc1ccc(Cl)cc1Cl)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C13H11Cl2NO4S2/c1-16(22(18,19)13-3-2-6-21-13)8-12(17)20-11-5-4-9(14)7-10(11)15/h2-7H,8H2,1H3 |
| InChIKey | DQGPIOIFWAKHAG-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.27 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|