C14H14ClN3O4S2 — CID 17485175
N-[2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl]-N-methylthiophene-2-sulfonamide (PubChem CID 17485175) has the molecular formula C14H14ClN3O4S2 and a molecular weight of 387.87 g/mol. Its IUPAC name is N-[2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl]-N-methylthiophene-2-sulfonamide.
| Compound Name | N-[2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl]-N-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 17485175 |
| Molecular Formula | C14H14ClN3O4S2 |
| Molecular Weight | 387.87 g/mol |
| Exact Mass | 387.01 |
| IUPAC Name | N-[2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl]-N-methylthiophene-2-sulfonamide |
| SMILES | CN(CC(=O)NNC(=O)c1ccc(Cl)cc1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C14H14ClN3O4S2/c1-18(24(21,22)13-3-2-8-23-13)9-12(19)16-17-14(20)10-4-6-11(15)7-5-10/h2-8H,9H2,1H3,(H,16,19)(H,17,20) |
| InChIKey | ZAGDOYGDANSWIS-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.87 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|