C9H13NO4S2 — CID 55028782
ethyl 2-[methyl(thiophen-2-ylsulfonyl)amino]acetate (PubChem CID 55028782) has the molecular formula C9H13NO4S2 and a molecular weight of 263.34 g/mol. Its IUPAC name is ethyl 2-[methyl(thiophen-2-ylsulfonyl)amino]acetate.
| Compound Name | ethyl 2-[methyl(thiophen-2-ylsulfonyl)amino]acetate |
|---|---|
| PubChem CID | 55028782 |
| Molecular Formula | C9H13NO4S2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.03 |
| IUPAC Name | ethyl 2-[methyl(thiophen-2-ylsulfonyl)amino]acetate |
| SMILES | CCOC(=O)CN(C)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C9H13NO4S2/c1-3-14-8(11)7-10(2)16(12,13)9-5-4-6-15-9/h4-6H,3,7H2,1-2H3 |
| InChIKey | GXTNPLBGPKYEGD-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |