C14H14ClNO4S2 — CID 7804745
benzyl 2-[(5-chlorothiophen-2-yl)sulfonyl-methylamino]acetate (PubChem CID 7804745) has the molecular formula C14H14ClNO4S2 and a molecular weight of 359.86 g/mol. Its IUPAC name is benzyl 2-[(5-chlorothiophen-2-yl)sulfonyl-methylamino]acetate.
| Compound Name | benzyl 2-[(5-chlorothiophen-2-yl)sulfonyl-methylamino]acetate |
|---|---|
| PubChem CID | 7804745 |
| Molecular Formula | C14H14ClNO4S2 |
| Molecular Weight | 359.86 g/mol |
| Exact Mass | 359.01 |
| IUPAC Name | benzyl 2-[(5-chlorothiophen-2-yl)sulfonyl-methylamino]acetate |
| SMILES | CN(CC(=O)OCc1ccccc1)S(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C14H14ClNO4S2/c1-16(22(18,19)14-8-7-12(15)21-14)9-13(17)20-10-11-5-3-2-4-6-11/h2-8H,9-10H2,1H3 |
| InChIKey | MCMCLAOMUSWJGE-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.86 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |