C16H18ClN3O4S2 — CID 38204108
N-[2-[[2-[(5-chlorothiophen-2-yl)sulfonyl-methylamino]acetyl]amino]ethyl]benzamide (PubChem CID 38204108) has the molecular formula C16H18ClN3O4S2 and a molecular weight of 415.92 g/mol. Its IUPAC name is N-[2-[[2-[(5-chlorothiophen-2-yl)sulfonyl-methylamino]acetyl]amino]ethyl]benzamide.
| Compound Name | N-[2-[[2-[(5-chlorothiophen-2-yl)sulfonyl-methylamino]acetyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 38204108 |
| Molecular Formula | C16H18ClN3O4S2 |
| Molecular Weight | 415.92 g/mol |
| Exact Mass | 415.04 |
| IUPAC Name | N-[2-[[2-[(5-chlorothiophen-2-yl)sulfonyl-methylamino]acetyl]amino]ethyl]benzamide |
| SMILES | CN(CC(=O)NCCNC(=O)c1ccccc1)S(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C16H18ClN3O4S2/c1-20(26(23,24)15-8-7-13(17)25-15)11-14(21)18-9-10-19-16(22)12-5-3-2-4-6-12/h2-8H,9-11H2,1H3,(H,18,21)(H,19,22) |
| InChIKey | LABCXFIBNCZDBB-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.92 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|