C16H25ClN2O4S2 — CID 31852144
2-[(5-chlorothiophen-2-yl)sulfonyl-methylamino]-N-(3-cyclohexyloxypropyl)acetamide (PubChem CID 31852144) has the molecular formula C16H25ClN2O4S2 and a molecular weight of 408.97 g/mol. Its IUPAC name is 2-[(5-chlorothiophen-2-yl)sulfonyl-methylamino]-N-(3-cyclohexyloxypropyl)acetamide.
| Compound Name | 2-[(5-chlorothiophen-2-yl)sulfonyl-methylamino]-N-(3-cyclohexyloxypropyl)acetamide |
|---|---|
| PubChem CID | 31852144 |
| Molecular Formula | C16H25ClN2O4S2 |
| Molecular Weight | 408.97 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | 2-[(5-chlorothiophen-2-yl)sulfonyl-methylamino]-N-(3-cyclohexyloxypropyl)acetamide |
| SMILES | CN(CC(=O)NCCCOC1CCCCC1)S(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C16H25ClN2O4S2/c1-19(25(21,22)16-9-8-14(17)24-16)12-15(20)18-10-5-11-23-13-6-3-2-4-7-13/h8-9,13H,2-7,10-12H2,1H3,(H,18,20) |
| InChIKey | HLLMJYUTAXLDSA-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.97 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|