C14H19ClN2O3S2 — CID 30372779
2-[(5-chlorothiophen-2-yl)sulfonyl-methylamino]-N-(dicyclopropylmethyl)acetamide (PubChem CID 30372779) has the molecular formula C14H19ClN2O3S2 and a molecular weight of 362.90 g/mol. Its IUPAC name is 2-[(5-chlorothiophen-2-yl)sulfonyl-methylamino]-N-(dicyclopropylmethyl)acetamide.
| Compound Name | 2-[(5-chlorothiophen-2-yl)sulfonyl-methylamino]-N-(dicyclopropylmethyl)acetamide |
|---|---|
| PubChem CID | 30372779 |
| Molecular Formula | C14H19ClN2O3S2 |
| Molecular Weight | 362.90 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | 2-[(5-chlorothiophen-2-yl)sulfonyl-methylamino]-N-(dicyclopropylmethyl)acetamide |
| SMILES | CN(CC(=O)NC(C1CC1)C1CC1)S(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C14H19ClN2O3S2/c1-17(22(19,20)13-7-6-11(15)21-13)8-12(18)16-14(9-2-3-9)10-4-5-10/h6-7,9-10,14H,2-5,8H2,1H3,(H,16,18) |
| InChIKey | ROKSIBRHVZXADH-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.90 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |