C8H12ClNO3S2 — CID 74225766
5-chloro-N-(2-methoxyethyl)-N-methylthiophene-2-sulfonamide (PubChem CID 74225766) has the molecular formula C8H12ClNO3S2 and a molecular weight of 269.77 g/mol. Its IUPAC name is 5-chloro-N-(2-methoxyethyl)-N-methylthiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-(2-methoxyethyl)-N-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 74225766 |
| Molecular Formula | C8H12ClNO3S2 |
| Molecular Weight | 269.77 g/mol |
| Exact Mass | 268.99 |
| IUPAC Name | 5-chloro-N-(2-methoxyethyl)-N-methylthiophene-2-sulfonamide |
| SMILES | COCCN(C)S(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C8H12ClNO3S2/c1-10(5-6-13-2)15(11,12)8-4-3-7(9)14-8/h3-4H,5-6H2,1-2H3 |
| InChIKey | WOBBREFFKDDNRD-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.77 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |