C8H13ClN2O2S2 — CID 96667362
N-(3-aminopropyl)-5-chloro-N-methylthiophene-2-sulfonamide (PubChem CID 96667362) has the molecular formula C8H13ClN2O2S2 and a molecular weight of 268.79 g/mol. Its IUPAC name is N-(3-aminopropyl)-5-chloro-N-methylthiophene-2-sulfonamide.
| Compound Name | N-(3-aminopropyl)-5-chloro-N-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 96667362 |
| Molecular Formula | C8H13ClN2O2S2 |
| Molecular Weight | 268.79 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | N-(3-aminopropyl)-5-chloro-N-methylthiophene-2-sulfonamide |
| SMILES | CN(CCCN)S(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C8H13ClN2O2S2/c1-11(6-2-5-10)15(12,13)8-4-3-7(9)14-8/h3-4H,2,5-6,10H2,1H3 |
| InChIKey | VWVZSPJZUOYIFP-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.79 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |