C13H21ClN2O3S2 — CID 78783696
N-butyl-2-[(5-chlorothiophen-2-yl)sulfonyl-methylamino]-N-ethylacetamide (PubChem CID 78783696) has the molecular formula C13H21ClN2O3S2 and a molecular weight of 352.91 g/mol. Its IUPAC name is N-butyl-2-[(5-chlorothiophen-2-yl)sulfonyl-methylamino]-N-ethylacetamide.
| Compound Name | N-butyl-2-[(5-chlorothiophen-2-yl)sulfonyl-methylamino]-N-ethylacetamide |
|---|---|
| PubChem CID | 78783696 |
| Molecular Formula | C13H21ClN2O3S2 |
| Molecular Weight | 352.91 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | N-butyl-2-[(5-chlorothiophen-2-yl)sulfonyl-methylamino]-N-ethylacetamide |
| SMILES | CCCCN(CC)C(=O)CN(C)S(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C13H21ClN2O3S2/c1-4-6-9-16(5-2)12(17)10-15(3)21(18,19)13-8-7-11(14)20-13/h7-8H,4-6,9-10H2,1-3H3 |
| InChIKey | RGYBMISKJFXZLM-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.91 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |