C8H11BrClNO2S2 — CID 106441802
N-(3-bromopropyl)-5-chloro-N-methylthiophene-2-sulfonamide (PubChem CID 106441802) has the molecular formula C8H11BrClNO2S2 and a molecular weight of 332.67 g/mol. Its IUPAC name is N-(3-bromopropyl)-5-chloro-N-methylthiophene-2-sulfonamide.
| Compound Name | N-(3-bromopropyl)-5-chloro-N-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106441802 |
| Molecular Formula | C8H11BrClNO2S2 |
| Molecular Weight | 332.67 g/mol |
| Exact Mass | 330.91 |
| IUPAC Name | N-(3-bromopropyl)-5-chloro-N-methylthiophene-2-sulfonamide |
| SMILES | CN(CCCBr)S(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C8H11BrClNO2S2/c1-11(6-2-5-9)15(12,13)8-4-3-7(10)14-8/h3-4H,2,5-6H2,1H3 |
| InChIKey | UZLGSWSQCDQVKJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.67 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|