C13H11ClF3NO2S2 — CID 134017189
5-chloro-N-methyl-N-[[4-(trifluoromethyl)phenyl]methyl]thiophene-2-sulfonamide (PubChem CID 134017189) has the molecular formula C13H11ClF3NO2S2 and a molecular weight of 369.82 g/mol. Its IUPAC name is 5-chloro-N-methyl-N-[[4-(trifluoromethyl)phenyl]methyl]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-methyl-N-[[4-(trifluoromethyl)phenyl]methyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 134017189 |
| Molecular Formula | C13H11ClF3NO2S2 |
| Molecular Weight | 369.82 g/mol |
| Exact Mass | 368.99 |
| IUPAC Name | 5-chloro-N-methyl-N-[[4-(trifluoromethyl)phenyl]methyl]thiophene-2-sulfonamide |
| SMILES | CN(Cc1ccc(C(F)(F)F)cc1)S(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C13H11ClF3NO2S2/c1-18(22(19,20)12-7-6-11(14)21-12)8-9-2-4-10(5-3-9)13(15,16)17/h2-7H,8H2,1H3 |
| InChIKey | NMKUNSYHYSWVLN-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.82 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |