C16H15BrF3NO3S — CID 55352516
5-bromo-2-methoxy-N-methyl-N-[[4-(trifluoromethyl)phenyl]methyl]benzenesulfonamide (PubChem CID 55352516) has the molecular formula C16H15BrF3NO3S and a molecular weight of 438.27 g/mol. Its IUPAC name is 5-bromo-2-methoxy-N-methyl-N-[[4-(trifluoromethyl)phenyl]methyl]benzenesulfonamide.
| Compound Name | 5-bromo-2-methoxy-N-methyl-N-[[4-(trifluoromethyl)phenyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 55352516 |
| Molecular Formula | C16H15BrF3NO3S |
| Molecular Weight | 438.27 g/mol |
| Exact Mass | 436.99 |
| IUPAC Name | 5-bromo-2-methoxy-N-methyl-N-[[4-(trifluoromethyl)phenyl]methyl]benzenesulfonamide |
| SMILES | COc1ccc(Br)cc1S(=O)(=O)N(C)Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H15BrF3NO3S/c1-21(10-11-3-5-12(6-4-11)16(18,19)20)25(22,23)15-9-13(17)7-8-14(15)24-2/h3-9H,10H2,1-2H3 |
| InChIKey | OPMCPMMFFIJGGG-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.27 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |