C12H12F3N3O2S — CID 60917171
N-methyl-N-[[4-(trifluoromethyl)phenyl]methyl]-1H-pyrazole-4-sulfonamide (PubChem CID 60917171) has the molecular formula C12H12F3N3O2S and a molecular weight of 319.31 g/mol. Its IUPAC name is N-methyl-N-[[4-(trifluoromethyl)phenyl]methyl]-1H-pyrazole-4-sulfonamide.
| Compound Name | N-methyl-N-[[4-(trifluoromethyl)phenyl]methyl]-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 60917171 |
| Molecular Formula | C12H12F3N3O2S |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | N-methyl-N-[[4-(trifluoromethyl)phenyl]methyl]-1H-pyrazole-4-sulfonamide |
| SMILES | CN(Cc1ccc(C(F)(F)F)cc1)S(=O)(=O)c1cn[nH]c1 |
| InChI | InChI=1S/C12H12F3N3O2S/c1-18(21(19,20)11-6-16-17-7-11)8-9-2-4-10(5-3-9)12(13,14)15/h2-7H,8H2,1H3,(H,16,17) |
| InChIKey | GLKZKGUHYIRXQG-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |