C9H14ClNO4S2 — CID 54999136
5-chloro-N-(2-hydroxy-3-methoxypropyl)-N-methylthiophene-2-sulfonamide (PubChem CID 54999136) has the molecular formula C9H14ClNO4S2 and a molecular weight of 299.80 g/mol. Its IUPAC name is 5-chloro-N-(2-hydroxy-3-methoxypropyl)-N-methylthiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-(2-hydroxy-3-methoxypropyl)-N-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 54999136 |
| Molecular Formula | C9H14ClNO4S2 |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 299.01 |
| IUPAC Name | 5-chloro-N-(2-hydroxy-3-methoxypropyl)-N-methylthiophene-2-sulfonamide |
| SMILES | COCC(O)CN(C)S(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C9H14ClNO4S2/c1-11(5-7(12)6-15-2)17(13,14)9-4-3-8(10)16-9/h3-4,7,12H,5-6H2,1-2H3 |
| InChIKey | ZCLVJTOBNLRDGF-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |