C14H19ClN4O3S2 — CID 86983067
N-(2-butylpyrazol-3-yl)-2-[(5-chlorothiophen-2-yl)sulfonyl-methylamino]acetamide (PubChem CID 86983067) has the molecular formula C14H19ClN4O3S2 and a molecular weight of 390.92 g/mol. Its IUPAC name is N-(2-butylpyrazol-3-yl)-2-[(5-chlorothiophen-2-yl)sulfonyl-methylamino]acetamide.
| Compound Name | N-(2-butylpyrazol-3-yl)-2-[(5-chlorothiophen-2-yl)sulfonyl-methylamino]acetamide |
|---|---|
| PubChem CID | 86983067 |
| Molecular Formula | C14H19ClN4O3S2 |
| Molecular Weight | 390.92 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | N-(2-butylpyrazol-3-yl)-2-[(5-chlorothiophen-2-yl)sulfonyl-methylamino]acetamide |
| SMILES | CCCCn1nccc1NC(=O)CN(C)S(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C14H19ClN4O3S2/c1-3-4-9-19-12(7-8-16-19)17-13(20)10-18(2)24(21,22)14-6-5-11(15)23-14/h5-8H,3-4,9-10H2,1-2H3,(H,17,20) |
| InChIKey | NZCMFQIQYFYVTL-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.92 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |