C16H21BrN4O3S — CID 55968028
2-[(4-bromophenyl)sulfonyl-methylamino]-N-(2-butylpyrazol-3-yl)acetamide (PubChem CID 55968028) has the molecular formula C16H21BrN4O3S and a molecular weight of 429.34 g/mol. Its IUPAC name is 2-[(4-bromophenyl)sulfonyl-methylamino]-N-(2-butylpyrazol-3-yl)acetamide.
| Compound Name | 2-[(4-bromophenyl)sulfonyl-methylamino]-N-(2-butylpyrazol-3-yl)acetamide |
|---|---|
| PubChem CID | 55968028 |
| Molecular Formula | C16H21BrN4O3S |
| Molecular Weight | 429.34 g/mol |
| Exact Mass | 428.05 |
| IUPAC Name | 2-[(4-bromophenyl)sulfonyl-methylamino]-N-(2-butylpyrazol-3-yl)acetamide |
| SMILES | CCCCn1nccc1NC(=O)CN(C)S(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H21BrN4O3S/c1-3-4-11-21-15(9-10-18-21)19-16(22)12-20(2)25(23,24)14-7-5-13(17)6-8-14/h5-10H,3-4,11-12H2,1-2H3,(H,19,22) |
| InChIKey | AQTYKRBRGGCTOC-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.34 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |