C17H19BrN2O5S2 — CID 55973446
2-[(4-bromophenyl)sulfonyl-methylamino]-N-(2-ethylsulfonylphenyl)acetamide (PubChem CID 55973446) has the molecular formula C17H19BrN2O5S2 and a molecular weight of 475.39 g/mol. Its IUPAC name is 2-[(4-bromophenyl)sulfonyl-methylamino]-N-(2-ethylsulfonylphenyl)acetamide.
| Compound Name | 2-[(4-bromophenyl)sulfonyl-methylamino]-N-(2-ethylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 55973446 |
| Molecular Formula | C17H19BrN2O5S2 |
| Molecular Weight | 475.39 g/mol |
| Exact Mass | 473.99 |
| IUPAC Name | 2-[(4-bromophenyl)sulfonyl-methylamino]-N-(2-ethylsulfonylphenyl)acetamide |
| SMILES | CCS(=O)(=O)c1ccccc1NC(=O)CN(C)S(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H19BrN2O5S2/c1-3-26(22,23)16-7-5-4-6-15(16)19-17(21)12-20(2)27(24,25)14-10-8-13(18)9-11-14/h4-11H,3,12H2,1-2H3,(H,19,21) |
| InChIKey | BUQYEIGRBUJEHD-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.39 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |