C15H19FN4O3S — CID 78772250
2-[(4-fluorophenyl)sulfonyl-methylamino]-N-(2-propan-2-ylpyrazol-3-yl)acetamide (PubChem CID 78772250) has the molecular formula C15H19FN4O3S and a molecular weight of 354.41 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)sulfonyl-methylamino]-N-(2-propan-2-ylpyrazol-3-yl)acetamide.
| Compound Name | 2-[(4-fluorophenyl)sulfonyl-methylamino]-N-(2-propan-2-ylpyrazol-3-yl)acetamide |
|---|---|
| PubChem CID | 78772250 |
| Molecular Formula | C15H19FN4O3S |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 2-[(4-fluorophenyl)sulfonyl-methylamino]-N-(2-propan-2-ylpyrazol-3-yl)acetamide |
| SMILES | CC(C)n1nccc1NC(=O)CN(C)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H19FN4O3S/c1-11(2)20-14(8-9-17-20)18-15(21)10-19(3)24(22,23)13-6-4-12(16)5-7-13/h4-9,11H,10H2,1-3H3,(H,18,21) |
| InChIKey | CNKRNVXHSATWTB-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |