C13H15ClN4O5S4 — CID 30750056
ethyl 2-[[5-[[2-[(5-chlorothiophen-2-yl)sulfonyl-methylamino]acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate (PubChem CID 30750056) has the molecular formula C13H15ClN4O5S4 and a molecular weight of 471.01 g/mol. Its IUPAC name is ethyl 2-[[5-[[2-[(5-chlorothiophen-2-yl)sulfonyl-methylamino]acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate.
| Compound Name | ethyl 2-[[5-[[2-[(5-chlorothiophen-2-yl)sulfonyl-methylamino]acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 30750056 |
| Molecular Formula | C13H15ClN4O5S4 |
| Molecular Weight | 471.01 g/mol |
| Exact Mass | 469.96 |
| IUPAC Name | ethyl 2-[[5-[[2-[(5-chlorothiophen-2-yl)sulfonyl-methylamino]acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
| SMILES | CCOC(=O)CSc1nnc(NC(=O)CN(C)S(=O)(=O)c2ccc(Cl)s2)s1 |
| InChI | InChI=1S/C13H15ClN4O5S4/c1-3-23-10(20)7-24-13-17-16-12(26-13)15-9(19)6-18(2)27(21,22)11-5-4-8(14)25-11/h4-5H,3,6-7H2,1-2H3,(H,15,16,19) |
| InChIKey | YQOIIUAWZFPBTM-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 118.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.01 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|