C9H15ClN4O3S2 — CID 119264963
ethyl 2-[[5-[[(2S)-2-aminopropanoyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate;hydrochloride (PubChem CID 119264963) has the molecular formula C9H15ClN4O3S2 and a molecular weight of 326.83 g/mol. Its IUPAC name is ethyl 2-[[5-[[(2S)-2-aminopropanoyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate;hydrochloride.
| Compound Name | ethyl 2-[[5-[[(2S)-2-aminopropanoyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate;hydrochloride |
|---|---|
| PubChem CID | 119264963 |
| Molecular Formula | C9H15ClN4O3S2 |
| Molecular Weight | 326.83 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | ethyl 2-[[5-[[(2S)-2-aminopropanoyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate;hydrochloride |
| SMILES | CCOC(=O)CSc1nnc(NC(=O)[C@H](C)N)s1.Cl |
| InChI | InChI=1S/C9H14N4O3S2.ClH/c1-3-16-6(14)4-17-9-13-12-8(18-9)11-7(15)5(2)10;/h5H,3-4,10H2,1-2H3,(H,11,12,15);1H/t5-;/m0./s1 |
| InChIKey | XHDNRWDFANVKNE-JEDNCBNOSA-N |
| XLogP | 0.90 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.83 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|