C15H15BrFN3O4S2 — CID 39880735
ethyl 2-[[5-[[(2R)-2-(2-bromo-4-fluorophenoxy)propanoyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate (PubChem CID 39880735) has the molecular formula C15H15BrFN3O4S2 and a molecular weight of 464.34 g/mol. Its IUPAC name is ethyl 2-[[5-[[(2R)-2-(2-bromo-4-fluorophenoxy)propanoyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate.
| Compound Name | ethyl 2-[[5-[[(2R)-2-(2-bromo-4-fluorophenoxy)propanoyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 39880735 |
| Molecular Formula | C15H15BrFN3O4S2 |
| Molecular Weight | 464.34 g/mol |
| Exact Mass | 462.97 |
| IUPAC Name | ethyl 2-[[5-[[(2R)-2-(2-bromo-4-fluorophenoxy)propanoyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
| SMILES | CCOC(=O)CSc1nnc(NC(=O)[C@@H](C)Oc2ccc(F)cc2Br)s1 |
| InChI | InChI=1S/C15H15BrFN3O4S2/c1-3-23-12(21)7-25-15-20-19-14(26-15)18-13(22)8(2)24-11-5-4-9(17)6-10(11)16/h4-6,8H,3,7H2,1-2H3,(H,18,19,22)/t8-/m1/s1 |
| InChIKey | UAEAKQAVEJJELU-MRVPVSSYSA-N |
| XLogP | 3.50 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.34 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|