C11H19ClN4O3S2 — CID 119264997
ethyl 2-[[5-[[(2S)-2-amino-3-methylbutanoyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate;hydrochloride (PubChem CID 119264997) has the molecular formula C11H19ClN4O3S2 and a molecular weight of 354.89 g/mol. Its IUPAC name is ethyl 2-[[5-[[(2S)-2-amino-3-methylbutanoyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate;hydrochloride.
| Compound Name | ethyl 2-[[5-[[(2S)-2-amino-3-methylbutanoyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate;hydrochloride |
|---|---|
| PubChem CID | 119264997 |
| Molecular Formula | C11H19ClN4O3S2 |
| Molecular Weight | 354.89 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | ethyl 2-[[5-[[(2S)-2-amino-3-methylbutanoyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate;hydrochloride |
| SMILES | CCOC(=O)CSc1nnc(NC(=O)[C@@H](N)C(C)C)s1.Cl |
| InChI | InChI=1S/C11H18N4O3S2.ClH/c1-4-18-7(16)5-19-11-15-14-10(20-11)13-9(17)8(12)6(2)3;/h6,8H,4-5,12H2,1-3H3,(H,13,14,17);1H/t8-;/m0./s1 |
| InChIKey | QMKPXFMACPFRJD-QRPNPIFTSA-N |
| XLogP | 1.54 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.89 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|