C11H20N2O2S3 — CID 114237748
5-(2-aminoethyl)-N-methyl-N-(3-methylsulfanylpropyl)thiophene-2-sulfonamide (PubChem CID 114237748) has the molecular formula C11H20N2O2S3 and a molecular weight of 308.49 g/mol. Its IUPAC name is 5-(2-aminoethyl)-N-methyl-N-(3-methylsulfanylpropyl)thiophene-2-sulfonamide.
| Compound Name | 5-(2-aminoethyl)-N-methyl-N-(3-methylsulfanylpropyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 114237748 |
| Molecular Formula | C11H20N2O2S3 |
| Molecular Weight | 308.49 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 5-(2-aminoethyl)-N-methyl-N-(3-methylsulfanylpropyl)thiophene-2-sulfonamide |
| SMILES | CSCCCN(C)S(=O)(=O)c1ccc(CCN)s1 |
| InChI | InChI=1S/C11H20N2O2S3/c1-13(8-3-9-16-2)18(14,15)11-5-4-10(17-11)6-7-12/h4-5H,3,6-9,12H2,1-2H3 |
| InChIKey | ZEXUIMQRLFUQDX-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.49 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|