C11H19N3O2S3 — CID 106271240
5-[3-(dimethylamino)propyl-methylsulfamoyl]thiophene-2-carbothioamide (PubChem CID 106271240) has the molecular formula C11H19N3O2S3 and a molecular weight of 321.49 g/mol. Its IUPAC name is 5-[3-(dimethylamino)propyl-methylsulfamoyl]thiophene-2-carbothioamide.
| Compound Name | 5-[3-(dimethylamino)propyl-methylsulfamoyl]thiophene-2-carbothioamide |
|---|---|
| PubChem CID | 106271240 |
| Molecular Formula | C11H19N3O2S3 |
| Molecular Weight | 321.49 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 5-[3-(dimethylamino)propyl-methylsulfamoyl]thiophene-2-carbothioamide |
| SMILES | CN(C)CCCN(C)S(=O)(=O)c1ccc(C(N)=S)s1 |
| InChI | InChI=1S/C11H19N3O2S3/c1-13(2)7-4-8-14(3)19(15,16)10-6-5-9(18-10)11(12)17/h5-6H,4,7-8H2,1-3H3,(H2,12,17) |
| InChIKey | JKABBXPSHGZIFZ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.49 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|