C11H17N3O3S3 — CID 106270824
2-[butyl-(5-carbamothioylthiophen-2-yl)sulfonylamino]acetamide (PubChem CID 106270824) has the molecular formula C11H17N3O3S3 and a molecular weight of 335.48 g/mol. Its IUPAC name is 2-[butyl-(5-carbamothioylthiophen-2-yl)sulfonylamino]acetamide.
| Compound Name | 2-[butyl-(5-carbamothioylthiophen-2-yl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 106270824 |
| Molecular Formula | C11H17N3O3S3 |
| Molecular Weight | 335.48 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | 2-[butyl-(5-carbamothioylthiophen-2-yl)sulfonylamino]acetamide |
| SMILES | CCCCN(CC(N)=O)S(=O)(=O)c1ccc(C(N)=S)s1 |
| InChI | InChI=1S/C11H17N3O3S3/c1-2-3-6-14(7-9(12)15)20(16,17)10-5-4-8(19-10)11(13)18/h4-5H,2-3,6-7H2,1H3,(H2,12,15)(H2,13,18) |
| InChIKey | ZLCQQKUVZHNMEH-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.48 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|