C10H13F3N2O2S3 — CID 106270865
5-[propyl(2,2,2-trifluoroethyl)sulfamoyl]thiophene-2-carbothioamide (PubChem CID 106270865) has the molecular formula C10H13F3N2O2S3 and a molecular weight of 346.42 g/mol. Its IUPAC name is 5-[propyl(2,2,2-trifluoroethyl)sulfamoyl]thiophene-2-carbothioamide.
| Compound Name | 5-[propyl(2,2,2-trifluoroethyl)sulfamoyl]thiophene-2-carbothioamide |
|---|---|
| PubChem CID | 106270865 |
| Molecular Formula | C10H13F3N2O2S3 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.01 |
| IUPAC Name | 5-[propyl(2,2,2-trifluoroethyl)sulfamoyl]thiophene-2-carbothioamide |
| SMILES | CCCN(CC(F)(F)F)S(=O)(=O)c1ccc(C(N)=S)s1 |
| InChI | InChI=1S/C10H13F3N2O2S3/c1-2-5-15(6-10(11,12)13)20(16,17)8-4-3-7(19-8)9(14)18/h3-4H,2,5-6H2,1H3,(H2,14,18) |
| InChIKey | XZTAHOFYKITRCH-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|