C12H15F3N2O3S — CID 51098722
4-[propyl(2,2,2-trifluoroethyl)sulfamoyl]benzamide (PubChem CID 51098722) has the molecular formula C12H15F3N2O3S and a molecular weight of 324.32 g/mol. Its IUPAC name is 4-[propyl(2,2,2-trifluoroethyl)sulfamoyl]benzamide.
| Compound Name | 4-[propyl(2,2,2-trifluoroethyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 51098722 |
| Molecular Formula | C12H15F3N2O3S |
| Molecular Weight | 324.32 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 4-[propyl(2,2,2-trifluoroethyl)sulfamoyl]benzamide |
| SMILES | CCCN(CC(F)(F)F)S(=O)(=O)c1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C12H15F3N2O3S/c1-2-7-17(8-12(13,14)15)21(19,20)10-5-3-9(4-6-10)11(16)18/h3-6H,2,7-8H2,1H3,(H2,16,18) |
| InChIKey | KRANEZIMIXBGPM-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.32 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |