C15H13F3N2O3S — CID 72724687
4-[benzenesulfonyl(2,2,2-trifluoroethyl)amino]benzamide (PubChem CID 72724687) has the molecular formula C15H13F3N2O3S and a molecular weight of 358.34 g/mol. Its IUPAC name is 4-[benzenesulfonyl(2,2,2-trifluoroethyl)amino]benzamide.
| Compound Name | 4-[benzenesulfonyl(2,2,2-trifluoroethyl)amino]benzamide |
|---|---|
| PubChem CID | 72724687 |
| Molecular Formula | C15H13F3N2O3S |
| Molecular Weight | 358.34 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | 4-[benzenesulfonyl(2,2,2-trifluoroethyl)amino]benzamide |
| SMILES | NC(=O)c1ccc(N(CC(F)(F)F)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C15H13F3N2O3S/c16-15(17,18)10-20(12-8-6-11(7-9-12)14(19)21)24(22,23)13-4-2-1-3-5-13/h1-9H,10H2,(H2,19,21) |
| InChIKey | RFMBLAPGRBGNQC-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.34 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |