C17H12F9NO3S — CID 87929763
N-[4-(1,1,2,3,3,3-hexafluoro-2-hydroxypropyl)phenyl]-N-(2,2,2-trifluoroethyl)benzenesulfonamide (PubChem CID 87929763) has the molecular formula C17H12F9NO3S and a molecular weight of 481.34 g/mol. Its IUPAC name is N-[4-(1,1,2,3,3,3-hexafluoro-2-hydroxypropyl)phenyl]-N-(2,2,2-trifluoroethyl)benzenesulfonamide.
| Compound Name | N-[4-(1,1,2,3,3,3-hexafluoro-2-hydroxypropyl)phenyl]-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 87929763 |
| Molecular Formula | C17H12F9NO3S |
| Molecular Weight | 481.34 g/mol |
| Exact Mass | 481.04 |
| IUPAC Name | N-[4-(1,1,2,3,3,3-hexafluoro-2-hydroxypropyl)phenyl]-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
| SMILES | O=S(=O)(c1ccccc1)N(CC(F)(F)F)c1ccc(C(F)(F)C(O)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H12F9NO3S/c18-14(19,20)10-27(31(29,30)13-4-2-1-3-5-13)12-8-6-11(7-9-12)15(21,22)16(23,28)17(24,25)26/h1-9,28H,10H2 |
| InChIKey | GVAWSMZIODRIQT-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.34 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |