C20H19F6NO3S — CID 45489655
N-ethyl-N-[4-(1,1,1,3,3,3-hexafluoro-2-prop-2-enoxypropan-2-yl)phenyl]benzenesulfonamide (PubChem CID 45489655) has the molecular formula C20H19F6NO3S and a molecular weight of 467.43 g/mol. Its IUPAC name is N-ethyl-N-[4-(1,1,1,3,3,3-hexafluoro-2-prop-2-enoxypropan-2-yl)phenyl]benzenesulfonamide.
| Compound Name | N-ethyl-N-[4-(1,1,1,3,3,3-hexafluoro-2-prop-2-enoxypropan-2-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 45489655 |
| Molecular Formula | C20H19F6NO3S |
| Molecular Weight | 467.43 g/mol |
| Exact Mass | 467.10 |
| IUPAC Name | N-ethyl-N-[4-(1,1,1,3,3,3-hexafluoro-2-prop-2-enoxypropan-2-yl)phenyl]benzenesulfonamide |
| SMILES | C=CCOC(c1ccc(N(CC)S(=O)(=O)c2ccccc2)cc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C20H19F6NO3S/c1-3-14-30-18(19(21,22)23,20(24,25)26)15-10-12-16(13-11-15)27(4-2)31(28,29)17-8-6-5-7-9-17/h3,5-13H,1,4,14H2,2H3 |
| InChIKey | XGOMWWOQXQUUDD-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.43 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|