C14H12F9NO3S — CID 72722948
N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-N-(2,2,2-trifluoroethyl)cyclopropanesulfonamide (PubChem CID 72722948) has the molecular formula C14H12F9NO3S and a molecular weight of 445.30 g/mol. Its IUPAC name is N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-N-(2,2,2-trifluoroethyl)cyclopropanesulfonamide.
| Compound Name | N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-N-(2,2,2-trifluoroethyl)cyclopropanesulfonamide |
|---|---|
| PubChem CID | 72722948 |
| Molecular Formula | C14H12F9NO3S |
| Molecular Weight | 445.30 g/mol |
| Exact Mass | 445.04 |
| IUPAC Name | N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-N-(2,2,2-trifluoroethyl)cyclopropanesulfonamide |
| SMILES | O=S(=O)(C1CC1)N(CC(F)(F)F)c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H12F9NO3S/c15-11(16,17)7-24(28(26,27)10-5-6-10)9-3-1-8(2-4-9)12(25,13(18,19)20)14(21,22)23/h1-4,10,25H,5-7H2 |
| InChIKey | CEQRXBRVPWBNGW-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.30 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |