C24H17F6NO3S — CID 24776339
N-(2,2,2-trifluoroethyl)-N-[4-(1,1,1-trifluoro-2-hydroxy-4-phenylbut-3-yn-2-yl)phenyl]benzenesulfonamide (PubChem CID 24776339) has the molecular formula C24H17F6NO3S and a molecular weight of 513.46 g/mol. Its IUPAC name is N-(2,2,2-trifluoroethyl)-N-[4-(1,1,1-trifluoro-2-hydroxy-4-phenylbut-3-yn-2-yl)phenyl]benzenesulfonamide.
| Compound Name | N-(2,2,2-trifluoroethyl)-N-[4-(1,1,1-trifluoro-2-hydroxy-4-phenylbut-3-yn-2-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 24776339 |
| Molecular Formula | C24H17F6NO3S |
| Molecular Weight | 513.46 g/mol |
| Exact Mass | 513.08 |
| IUPAC Name | N-(2,2,2-trifluoroethyl)-N-[4-(1,1,1-trifluoro-2-hydroxy-4-phenylbut-3-yn-2-yl)phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(c1ccccc1)N(CC(F)(F)F)c1ccc(C(O)(C#Cc2ccccc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H17F6NO3S/c25-23(26,27)17-31(35(33,34)21-9-5-2-6-10-21)20-13-11-19(12-14-20)22(32,24(28,29)30)16-15-18-7-3-1-4-8-18/h1-14,32H,17H2 |
| InChIKey | SAKKPZOSAFYJBK-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.46 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|