C16H12F9NO3S2 — CID 162577615
N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-5-methyl-N-(2,2,2-trifluoroethyl)thiophene-3-sulfonamide (PubChem CID 162577615) has the molecular formula C16H12F9NO3S2 and a molecular weight of 501.39 g/mol. Its IUPAC name is N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-5-methyl-N-(2,2,2-trifluoroethyl)thiophene-3-sulfonamide.
| Compound Name | N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-5-methyl-N-(2,2,2-trifluoroethyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 162577615 |
| Molecular Formula | C16H12F9NO3S2 |
| Molecular Weight | 501.39 g/mol |
| Exact Mass | 501.01 |
| IUPAC Name | N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-5-methyl-N-(2,2,2-trifluoroethyl)thiophene-3-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)N(CC(F)(F)F)c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2)cs1 |
| InChI | InChI=1S/C16H12F9NO3S2/c1-9-6-12(7-30-9)31(28,29)26(8-13(17,18)19)11-4-2-10(3-5-11)14(27,15(20,21)22)16(23,24)25/h2-7,27H,8H2,1H3 |
| InChIKey | WEPLUJNBDNBPFE-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.39 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |