C27H26F6N2O6S — CID 23519223
2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-N-(4-methoxyphenyl)sulfonylanilino]-N-[1-(4-methoxyphenyl)ethyl]acetamide (PubChem CID 23519223) has the molecular formula C27H26F6N2O6S and a molecular weight of 620.57 g/mol. Its IUPAC name is 2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-N-(4-methoxyphenyl)sulfonylanilino]-N-[1-(4-methoxyphenyl)ethyl]acetamide.
| Compound Name | 2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-N-(4-methoxyphenyl)sulfonylanilino]-N-[1-(4-methoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 23519223 |
| Molecular Formula | C27H26F6N2O6S |
| Molecular Weight | 620.57 g/mol |
| Exact Mass | 620.14 |
| IUPAC Name | 2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-N-(4-methoxyphenyl)sulfonylanilino]-N-[1-(4-methoxyphenyl)ethyl]acetamide |
| SMILES | COc1ccc(C(C)NC(=O)CN(c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2)S(=O)(=O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C27H26F6N2O6S/c1-17(18-4-10-21(40-2)11-5-18)34-24(36)16-35(42(38,39)23-14-12-22(41-3)13-15-23)20-8-6-19(7-9-20)25(37,26(28,29)30)27(31,32)33/h4-15,17,37H,16H2,1-3H3,(H,34,36) |
| InChIKey | DNWNWJYJKCVQAK-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.57 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |