C28H33N3O6S — CID 99130148
N-[(1S)-1-(4-tert-butylphenyl)ethyl]-2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetamide (PubChem CID 99130148) has the molecular formula C28H33N3O6S and a molecular weight of 539.65 g/mol. Its IUPAC name is N-[(1S)-1-(4-tert-butylphenyl)ethyl]-2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetamide.
| Compound Name | N-[(1S)-1-(4-tert-butylphenyl)ethyl]-2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 99130148 |
| Molecular Formula | C28H33N3O6S |
| Molecular Weight | 539.65 g/mol |
| Exact Mass | 539.21 |
| IUPAC Name | N-[(1S)-1-(4-tert-butylphenyl)ethyl]-2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetamide |
| SMILES | COc1ccc(N(CC(=O)N[C@@H](C)c2ccc(C(C)(C)C)cc2)S(=O)(=O)c2ccc(C)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C28H33N3O6S/c1-19-7-16-25(17-26(19)31(33)34)38(35,36)30(23-12-14-24(37-6)15-13-23)18-27(32)29-20(2)21-8-10-22(11-9-21)28(3,4)5/h7-17,20H,18H2,1-6H3,(H,29,32)/t20-/m0/s1 |
| InChIKey | OJHAHLXKLOCWKE-FQEVSTJZSA-N |
| XLogP | 5.28 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.65 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|