C27H29N3O6S — CID 133188704
N-[1-(2,3-dihydro-1H-inden-5-yl)ethyl]-2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetamide (PubChem CID 133188704) has the molecular formula C27H29N3O6S and a molecular weight of 523.61 g/mol. Its IUPAC name is N-[1-(2,3-dihydro-1H-inden-5-yl)ethyl]-2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetamide.
| Compound Name | N-[1-(2,3-dihydro-1H-inden-5-yl)ethyl]-2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 133188704 |
| Molecular Formula | C27H29N3O6S |
| Molecular Weight | 523.61 g/mol |
| Exact Mass | 523.18 |
| IUPAC Name | N-[1-(2,3-dihydro-1H-inden-5-yl)ethyl]-2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetamide |
| SMILES | COc1ccc(N(CC(=O)NC(C)c2ccc3c(c2)CCC3)S(=O)(=O)c2ccc(C)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C27H29N3O6S/c1-18-7-14-25(16-26(18)30(32)33)37(34,35)29(23-10-12-24(36-3)13-11-23)17-27(31)28-19(2)21-9-8-20-5-4-6-22(20)15-21/h7-16,19H,4-6,17H2,1-3H3,(H,28,31) |
| InChIKey | STEPNCQUBXUCQM-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.61 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|