C14H13ClN2O4S — CID 175228763
benzene-1,4-dicarboxamide;benzenesulfonyl chloride (PubChem CID 175228763) has the molecular formula C14H13ClN2O4S and a molecular weight of 340.79 g/mol. Its IUPAC name is benzene-1,4-dicarboxamide;benzenesulfonyl chloride.
| Compound Name | benzene-1,4-dicarboxamide;benzenesulfonyl chloride |
|---|---|
| PubChem CID | 175228763 |
| Molecular Formula | C14H13ClN2O4S |
| Molecular Weight | 340.79 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | benzene-1,4-dicarboxamide;benzenesulfonyl chloride |
| SMILES | NC(=O)c1ccc(C(N)=O)cc1.O=S(=O)(Cl)c1ccccc1 |
| InChI | InChI=1S/C8H8N2O2.C6H5ClO2S/c9-7(11)5-1-2-6(4-3-5)8(10)12;7-10(8,9)6-4-2-1-3-5-6/h1-4H,(H2,9,11)(H2,10,12);1-5H |
| InChIKey | NQBGNAYAUMNPRE-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.79 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |