C11H17N3O4S3 — CID 106270760
2-[(5-carbamothioylthiophen-2-yl)sulfonyl-methylamino]-N-(2-methoxyethyl)acetamide (PubChem CID 106270760) has the molecular formula C11H17N3O4S3 and a molecular weight of 351.48 g/mol. Its IUPAC name is 2-[(5-carbamothioylthiophen-2-yl)sulfonyl-methylamino]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[(5-carbamothioylthiophen-2-yl)sulfonyl-methylamino]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 106270760 |
| Molecular Formula | C11H17N3O4S3 |
| Molecular Weight | 351.48 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | 2-[(5-carbamothioylthiophen-2-yl)sulfonyl-methylamino]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)CN(C)S(=O)(=O)c1ccc(C(N)=S)s1 |
| InChI | InChI=1S/C11H17N3O4S3/c1-14(7-9(15)13-5-6-18-2)21(16,17)10-4-3-8(20-10)11(12)19/h3-4H,5-7H2,1-2H3,(H2,12,19)(H,13,15) |
| InChIKey | RLIAWUDAFFBYQP-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.48 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|